Write the half-reaction for the silver-silver chloride reference electrode. Include physical states.half-reaction: AgCl(s) + e Ag(s) + Cl¯ (aq)Write the half-reaction for the saturated calomel reference electrode. Include physical states.half-reaction: Hg₂ Cl₂ (s) + 2e2Hg(s) + 2C1 (aq)What is the potential of the cellIncorrectsilver-silver chloride electrode || saturated calomel electrodegiven that the potential for the Ag|AgCl electrode in a saturated KCl solution is +0.197 V and the potential for a saturatedcalomel electrode is +0.241 V?E =0.044V

Given reference electrodes:silver-silver chloride reference electrodesaturated calomel reference…

Write the half-reaction for the silver-silver chloride reference electrode. Include physical states. half-reaction: AgCl(s) + e Ag(s) + Cl¯ (aq) Write the half-reaction for the saturated calomel reference electrode. Include physical states. half-reaction: Hg₂ Cl₂(s) + 2e E = Incorrect What is the potential of the cell silver-silver chloride electrode || saturated calomel electrode given that the potential for the Ag|AgCl electrode in a saturated KCl solution is +0.197 V and the potential for a saturated calomel electrode is +0.241 V? 0.044 2Hg(s) + 2CI (aq) V

Write the half-reaction for the silver-silver chloride reference electrode. Include physical states. half-reaction: AgCl(s) + e Ag(s) + Cl¯ (aq) Write the half-reaction for the saturated calomel reference electrode. Include physical states. half-reaction: Hg₂ Cl₂(s) + 2e E = Incorrect What is the potential of the cell silver-silver chloride electrode || saturated calomel electrode given that the potential for the Ag|AgCl electrode in a saturated KCl solution is +0.197 V and the potential for a saturated calomel electrode is +0.241 V? 0.044 2Hg(s) + 2CI (aq) V

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.50QE

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.
Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)